5-Chloro-2-methylbenzoic acid
Catalog No: FT-0658063
CAS No: 7499-06-1
- Chemical Name: 5-Chloro-2-methylbenzoic acid
- Molecular Formula: C8H7ClO2
- Molecular Weight: 170.59
- InChI Key: CSAPESWNZDOAFU-UHFFFAOYSA-N
- InChI: InChI=1S/C8H7ClO2/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4H,1H3,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS05, GHS07 |
|---|---|
| CAS: | 7499-06-1 |
| Flash_Point: | 131.3±21.8 °C |
| Product_Name: | 5-Chloro-2-methylbenzoic acid |
| Bolling_Point: | 293.5±20.0 °C at 760 mmHg |
| FW: | 170.593 |
| Melting_Point: | 168ºC |
| MF: | C8H7ClO2 |
| Density: | 1.3±0.1 g/cm3 |
| Refractive_Index: | 1.573 |
|---|---|
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Flash_Point: | 131.3±21.8 °C |
| LogP: | 3.36 |
| Bolling_Point: | 293.5±20.0 °C at 760 mmHg |
| FW: | 170.593 |
| PSA: | 37.30000 |
| Melting_Point: | 168ºC |
| MF: | C8H7ClO2 |
| Exact_Mass: | 170.013458 |
| Density: | 1.3±0.1 g/cm3 |
| Symbol: | GHS05, GHS07 |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| HS_Code: | 2916399090 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi,Xn |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H318-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)